0
You visited us 0 times! Enjoying our articles? Unlock Full Access!
Question

What happens when lactic acid is treated with PCl5? Write the equation.

Solution
Verified by Toppr

When lactric acid is treated with PCl5, it forms lactyl chloride.
CH3CH(OH)COOH+PCl5CH3CH(Cl)COCl

Was this answer helpful?
2
Similar Questions
Q1
What happens when lactic acid is treated with PCl5? Write the equation.
View Solution
Q2
What happens when salicylic acid is treated with (CH3CO)2O/H+? Write chemical equation in support of your answer.
View Solution
Q3
(i) What happens when zinc granules are treated with dilute solution of H2SO4? Also write the chemical equations if reaction occurs.

(ii) What happens when zinc granules are treated with dilute solution of HCl? Also write the chemical equations if reaction occurs.

(iii) What happens when zinc granules are treated with dilute solution of HNO3? Also write the chemical equations if reaction occurs.

(iv) What happens when zinc granules are treated with dilute solution of NaCl? Also write the chemical equations if reaction occurs.

(v) What happens when zinc granules are treated with dilute solution of NaOH? Also write the chemical equations if reaction occurs.
View Solution
Q4
What happens when acetic acid is treated with carbonate salt? Name the gas produced. What happens when this gas is treated with lime water? Support your answer with equations.
622986_e753b44cbeb64770802778a9cff9ce3c.png
View Solution
Q5
What happens when anisole is treated with CH3Cl/anhydrousAlCl3? Write chemical equation in support of your answer.
View Solution