Which of the following is a Sandmeyer reaction?
$2 C_{6} H_{5} C l {C u}_{2} {C l}_{2} / H C l - ------- \to C_{6} H_{6} + {C l}_{2}$
$C_{6} H_{5} N_{2} C l {C u}_{2} {C l}_{2} / H C l - ------- \to C_{6} H_{5} C l + N_{2}$
$C_{6} H_{5} O H Z n d u s t - ---- \to C_{6} H_{6} + Z n O$
$C_{6} H_{5} {N O}_{2} + 6 [H] S n / H C l - ---- \to C_{6} H_{5} {N H}_{2} + 2 H_{2} O$

Question

Which of the following is a Sandmeyer reaction?
$2 C_{6} H_{5} C l {C u}_{2} {C l}_{2} / H C l - ------- \to C_{6} H_{6} + {C l}_{2}$
$C_{6} H_{5} N_{2} C l {C u}_{2} {C l}_{2} / H C l - ------- \to C_{6} H_{5} C l + N_{2}$
$C_{6} H_{5} O H Z n d u s t - ---- \to C_{6} H_{6} + Z n O$
$C_{6} H_{5} {N O}_{2} + 6 [H] S n / H C l - ---- \to C_{6} H_{5} {N H}_{2} + 2 H_{2} O$

Toppr Admin · Accepted Answer

In Sandmeyer-apos-s reaction- an arenediazonium salt reacts with cuprous chloride in hydrochloric acid to form chlorobenzene-So- option B is the correct answer-

Which of the following is a Sandmeyer reaction?2C6H5ClCu2Cl2/HCl−−−−−−−−→C6H6+Cl2C6H5N2ClCu2Cl2/HCl−−−−−−−−→C6H5Cl+N2C6H5OHZndust−−−−−→C6H6+ZnOC6H5NO2+6[H]Sn/HCl−−−−−→C6H5NH2+2H2O

In Sandmeyer's reaction, an arenediazonium salt reacts with cuprous chloride in hydrochloric acid to form chlorobenzene.So, option B is the correct answer.

In Sandmeyer's reaction, an arenediazonium salt reacts with cuprous chloride in hydrochloric acid to form chlorobenzene.
So, option $B$ is the correct answer.